C19H18N6O6S3 — CID 88778459
(6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenyl-2-sulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88778459) has the molecular formula C19H18N6O6S3 and a molecular weight of 522.59 g/mol. Its IUPAC name is (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenyl-2-sulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenyl-2-sulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88778459 |
| Molecular Formula | C19H18N6O6S3 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenyl-2-sulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(=S=O)c2ccccc2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
| InChI | InChI=1S/C19H18N6O6S3/c1-24-18(21-22-23-24)33-9-11-8-32-17-19(31-2,16(29)25(17)12(11)15(27)28)20-14(26)13(34-30)10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3,(H,20,26)(H,27,28)/t17-,19+/m1/s1 |
| InChIKey | YZEMWHBLXPTENM-MJGOQNOKSA-N |
| XLogP | -0.55 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|