C17H17N7O6S3 — CID 154004312
(6R,7S)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154004312) has the molecular formula C17H17N7O6S3 and a molecular weight of 511.57 g/mol. Its IUPAC name is (6R,7S)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154004312 |
| Molecular Formula | C17H17N7O6S3 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | (6R,7S)-7-[(2-hydroxyimino-2-thiophen-2-ylacetyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(=NO)c2cccs2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
| InChI | InChI=1S/C17H17N7O6S3/c1-23-16(19-21-22-23)33-7-8-6-32-15-17(30-2,14(28)24(15)11(8)13(26)27)18-12(25)10(20-29)9-4-3-5-31-9/h3-5,15,29H,6-7H2,1-2H3,(H,18,25)(H,26,27)/t15-,17+/m1/s1 |
| InChIKey | KPGCCRCWCKKZQQ-WBVHZDCISA-N |
| XLogP | -0.05 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|