C17H14N4O7S4 — CID 88778422
(6R,7S)-7-methoxy-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88778422) has the molecular formula C17H14N4O7S4 and a molecular weight of 514.59 g/mol. Its IUPAC name is (6R,7S)-7-methoxy-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-methoxy-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88778422 |
| Molecular Formula | C17H14N4O7S4 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | (6R,7S)-7-methoxy-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(=S=O)c2cccs2)C(=O)N2C(C(=O)O)=C(CSc3nnco3)CS[C@@H]21 |
| InChI | InChI=1S/C17H14N4O7S4/c1-27-17(19-12(22)11(32-26)9-3-2-4-29-9)14(25)21-10(13(23)24)8(5-30-15(17)21)6-31-16-20-18-7-28-16/h2-4,7,15H,5-6H2,1H3,(H,19,22)(H,23,24)/t15-,17+/m1/s1 |
| InChIKey | PKSWSOZJMLZJRB-WBVHZDCISA-N |
| XLogP | 0.37 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|