C25H38O4 — CID 21310348
1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]prop-2-ynyl acetate (PubChem CID 21310348) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]prop-2-ynyl acetate.
| Compound Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]prop-2-ynyl acetate |
|---|---|
| PubChem CID | 21310348 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-17-methoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]prop-2-ynyl acetate |
| SMILES | C#CC(OC(C)=O)[C@@]1(O)CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](OC)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H38O4/c1-6-21(29-16(2)26)25(27)14-13-23(3)17(15-25)7-8-18-19-9-10-22(28-5)24(19,4)12-11-20(18)23/h1,17-22,27H,7-15H2,2-5H3/t17-,18+,19+,20+,21?,22+,23+,24+,25-/m1/s1 |
| InChIKey | TZIJDWSAFSOIDO-IXYPCRGLSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|