C23H33NO3 — CID 54449757
[(8R,9S,10S,13S,14S,17S)-3'-cyano-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane]-17-yl] acetate (PubChem CID 54449757) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17S)-3'-cyano-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane]-17-yl] acetate.
| Compound Name | [(8R,9S,10S,13S,14S,17S)-3'-cyano-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane]-17-yl] acetate |
|---|---|
| PubChem CID | 54449757 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17S)-3'-cyano-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane]-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4CC5(CC[C@]4(C)[C@H]3CC[C@]12C)OC5C#N |
| InChI | InChI=1S/C23H33NO3/c1-14(25)26-19-7-6-17-16-5-4-15-12-23(20(13-24)27-23)11-10-21(15,2)18(16)8-9-22(17,19)3/h15-20H,4-12H2,1-3H3/t15?,16-,17-,18-,19-,20?,21-,22-,23?/m0/s1 |
| InChIKey | WUCIWRGELJCHAO-BGSLBUCNSA-N |
| XLogP | 4.62 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|