C21H24N2O5 — CID 21311416
(1S,2R,3S,4S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 21311416) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2R,3S,4S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 21311416 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (1S,2R,3S,4S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@@H](C(=O)N2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C21H24N2O5/c24-20(18-14-2-3-15(10-14)19(18)21(25)26)23-7-5-22(6-8-23)11-13-1-4-16-17(9-13)28-12-27-16/h1-4,9,14-15,18-19H,5-8,10-12H2,(H,25,26)/t14-,15-,18+,19-/m1/s1 |
| InChIKey | YQVLWQQRECZUMI-VVWQDTPRSA-N |
| XLogP | -1.17 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|