C13H22NO4PS2 — CID 21311960
N-diethoxyphosphinothioyl-N-(2,4-dimethylphenyl)methanesulfonamide (PubChem CID 21311960) has the molecular formula C13H22NO4PS2 and a molecular weight of 351.43 g/mol. Its IUPAC name is N-diethoxyphosphinothioyl-N-(2,4-dimethylphenyl)methanesulfonamide.
| Compound Name | N-diethoxyphosphinothioyl-N-(2,4-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 21311960 |
| Molecular Formula | C13H22NO4PS2 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-diethoxyphosphinothioyl-N-(2,4-dimethylphenyl)methanesulfonamide |
| SMILES | CCOP(=S)(OCC)N(c1ccc(C)cc1C)S(C)(=O)=O |
| InChI | InChI=1S/C13H22NO4PS2/c1-6-17-19(20,18-7-2)14(21(5,15)16)13-9-8-11(3)10-12(13)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | BSLLBHUPJGMYTJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|