About N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline
N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline (PubChem CID 6431964) has the molecular formula C18H25N2O2P
and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline |
| PubChem CID | 6431964 |
| Molecular Formula | C18H25N2O2P |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline |
| SMILES | CCOP(=O)(Nc1ccc(C)cc1C)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C18H25N2O2P/c1-6-22-23(21,19-17-9-7-13(2)11-15(17)4)20-18-10-8-14(3)12-16(18)5/h7-12H,6H2,1-5H3,(H2,19,20,21) |
| InChIKey | MXPYFDYSXONIRX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline?
The IUPAC name of N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline (CID 6431964) is N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline.
What is the SMILES notation for N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline?
The canonical SMILES for N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline is CCOP(=O)(Nc1ccc(C)cc1C)Nc1ccc(C)cc1C.
What is the InChIKey of N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline?
The InChIKey is MXPYFDYSXONIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N2O2P/c1-6-22-23(21,19-17-9-7-13(2)11-15(17)4)20-18-10-8-14(3)12-16(18)5/h7-12H,6H2,1-5H3,(H2,19,20,21).
What are the key properties of N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline?
N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline has a molecular weight of 332.38 g/mol, XLogP of 5.59, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline is sourced from PubChem (CID 6431964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).