C18H25N2O2P — CID 6431964
N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline (PubChem CID 6431964) has the molecular formula C18H25N2O2P and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline.
| Compound Name | N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 6431964 |
| Molecular Formula | C18H25N2O2P |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[(2,4-dimethylanilino)-ethoxyphosphoryl]-2,4-dimethylaniline |
| SMILES | CCOP(=O)(Nc1ccc(C)cc1C)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C18H25N2O2P/c1-6-22-23(21,19-17-9-7-13(2)11-15(17)4)20-18-10-8-14(3)12-16(18)5/h7-12H,6H2,1-5H3,(H2,19,20,21) |
| InChIKey | MXPYFDYSXONIRX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|