About N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline
N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline (PubChem CID 2313169) has the molecular formula C24H28NO3P
and a molecular weight of 409.47 g/mol. Its IUPAC name is N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline |
| PubChem CID | 2313169 |
| Molecular Formula | C24H28NO3P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline |
| SMILES | Cc1ccc(NP(=O)(Oc2cccc(C)c2C)Oc2cccc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C24H28NO3P/c1-16-13-14-22(19(4)15-16)25-29(26,27-23-11-7-9-17(2)20(23)5)28-24-12-8-10-18(3)21(24)6/h7-15H,1-6H3,(H,25,26) |
| InChIKey | OGIPPVVWZQHABA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline?
The IUPAC name of N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline (CID 2313169) is N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline.
What is the SMILES notation for N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline?
The canonical SMILES for N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline is Cc1ccc(NP(=O)(Oc2cccc(C)c2C)Oc2cccc(C)c2C)c(C)c1.
What is the InChIKey of N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline?
The InChIKey is OGIPPVVWZQHABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28NO3P/c1-16-13-14-22(19(4)15-16)25-29(26,27-23-11-7-9-17(2)20(23)5)28-24-12-8-10-18(3)21(24)6/h7-15H,1-6H3,(H,25,26).
What are the key properties of N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline?
N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline has a molecular weight of 409.47 g/mol, XLogP of 7.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline is sourced from PubChem (CID 2313169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).