C24H28NO3P — CID 2313169
N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline (PubChem CID 2313169) has the molecular formula C24H28NO3P and a molecular weight of 409.47 g/mol. Its IUPAC name is N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline.
| Compound Name | N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline |
|---|---|
| PubChem CID | 2313169 |
| Molecular Formula | C24H28NO3P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-bis(2,3-dimethylphenoxy)phosphoryl-2,4-dimethylaniline |
| SMILES | Cc1ccc(NP(=O)(Oc2cccc(C)c2C)Oc2cccc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C24H28NO3P/c1-16-13-14-22(19(4)15-16)25-29(26,27-23-11-7-9-17(2)20(23)5)28-24-12-8-10-18(3)21(24)6/h7-15H,1-6H3,(H,25,26) |
| InChIKey | OGIPPVVWZQHABA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|