C21H20F2NO3P — CID 2067423
N-bis(2-fluorophenoxy)phosphoryl-2,4,6-trimethylaniline (PubChem CID 2067423) has the molecular formula C21H20F2NO3P and a molecular weight of 403.37 g/mol. Its IUPAC name is N-bis(2-fluorophenoxy)phosphoryl-2,4,6-trimethylaniline.
| Compound Name | N-bis(2-fluorophenoxy)phosphoryl-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 2067423 |
| Molecular Formula | C21H20F2NO3P |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-bis(2-fluorophenoxy)phosphoryl-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NP(=O)(Oc2ccccc2F)Oc2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C21H20F2NO3P/c1-14-12-15(2)21(16(3)13-14)24-28(25,26-19-10-6-4-8-17(19)22)27-20-11-7-5-9-18(20)23/h4-13H,1-3H3,(H,24,25) |
| InChIKey | JNJNBERUGGBHDF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|