C20H22FN3O2 — CID 4130260
3-[2-(2-fluorobenzoyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide (PubChem CID 4130260) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[2-(2-fluorobenzoyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide.
| Compound Name | 3-[2-(2-fluorobenzoyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 4130260 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[2-(2-fluorobenzoyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide |
| SMILES | CC(=CC(=O)Nc1c(C)cc(C)cc1C)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H22FN3O2/c1-12-9-13(2)19(14(3)10-12)22-18(25)11-15(4)23-24-20(26)16-7-5-6-8-17(16)21/h5-11,23H,1-4H3,(H,22,25)(H,24,26) |
| InChIKey | HPBZSXVXKVTLCY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|