C16H23N3O3 — CID 3306998
3-[2-(2-methoxyacetyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide (PubChem CID 3306998) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[2-(2-methoxyacetyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide.
| Compound Name | 3-[2-(2-methoxyacetyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 3306998 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[2-(2-methoxyacetyl)hydrazinyl]-N-(2,4,6-trimethylphenyl)but-2-enamide |
| SMILES | COCC(=O)NNC(C)=CC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H23N3O3/c1-10-6-11(2)16(12(3)7-10)17-14(20)8-13(4)18-19-15(21)9-22-5/h6-8,18H,9H2,1-5H3,(H,17,20)(H,19,21) |
| InChIKey | SXJXZMLTZPPNAY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|