C15H19Br2N3O3 — CID 3277242
3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-ethylbut-2-enamide (PubChem CID 3277242) has the molecular formula C15H19Br2N3O3 and a molecular weight of 449.14 g/mol. Its IUPAC name is 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-ethylbut-2-enamide.
| Compound Name | 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-ethylbut-2-enamide |
|---|---|
| PubChem CID | 3277242 |
| Molecular Formula | C15H19Br2N3O3 |
| Molecular Weight | 449.14 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-ethylbut-2-enamide |
| SMILES | CCNC(=O)C=C(C)NNC(=O)COc1cc(C)c(Br)cc1Br |
| InChI | InChI=1S/C15H19Br2N3O3/c1-4-18-14(21)6-10(3)19-20-15(22)8-23-13-5-9(2)11(16)7-12(13)17/h5-7,19H,4,8H2,1-3H3,(H,18,21)(H,20,22) |
| InChIKey | IDGMXNXZSMOJES-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|