C20H20Br2ClN3O3 — CID 6156343
(3Z)-N-[(4-chlorophenyl)methyl]-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide (PubChem CID 6156343) has the molecular formula C20H20Br2ClN3O3 and a molecular weight of 545.66 g/mol. Its IUPAC name is (3Z)-N-[(4-chlorophenyl)methyl]-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide.
| Compound Name | (3Z)-N-[(4-chlorophenyl)methyl]-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 6156343 |
| Molecular Formula | C20H20Br2ClN3O3 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | (3Z)-N-[(4-chlorophenyl)methyl]-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide |
| SMILES | C/C(CC(=O)NCc1ccc(Cl)cc1)=N/NC(=O)COc1cc(C)c(Br)cc1Br |
| InChI | InChI=1S/C20H20Br2ClN3O3/c1-12-7-18(17(22)9-16(12)21)29-11-20(28)26-25-13(2)8-19(27)24-10-14-3-5-15(23)6-4-14/h3-7,9H,8,10-11H2,1-2H3,(H,24,27)(H,26,28)/b25-13- |
| InChIKey | CFIQMOFDAKRTCE-MXAYSNPKSA-N |
| XLogP | 4.75 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|