C23H29Br2N3O3 — CID 6145836
(3Z)-N-(2-adamantyl)-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide (PubChem CID 6145836) has the molecular formula C23H29Br2N3O3 and a molecular weight of 555.31 g/mol. Its IUPAC name is (3Z)-N-(2-adamantyl)-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide.
| Compound Name | (3Z)-N-(2-adamantyl)-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 6145836 |
| Molecular Formula | C23H29Br2N3O3 |
| Molecular Weight | 555.31 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | (3Z)-N-(2-adamantyl)-3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]butanamide |
| SMILES | C/C(CC(=O)NC1C2CC3CC(C2)CC1C3)=N/NC(=O)COc1cc(C)c(Br)cc1Br |
| InChI | InChI=1S/C23H29Br2N3O3/c1-12-3-20(19(25)10-18(12)24)31-11-22(30)28-27-13(2)4-21(29)26-23-16-6-14-5-15(8-16)9-17(23)7-14/h3,10,14-17,23H,4-9,11H2,1-2H3,(H,26,29)(H,28,30)/b27-13- |
| InChIKey | WEUAORFUKDXEHZ-WKIKZPBSSA-N |
| XLogP | 4.72 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|