C19H24BrNO2 — CID 1370294
N-(2-adamantyl)-2-(2-bromo-4-methylphenoxy)acetamide (PubChem CID 1370294) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-(2-adamantyl)-2-(2-bromo-4-methylphenoxy)acetamide.
| Compound Name | N-(2-adamantyl)-2-(2-bromo-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 1370294 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(2-adamantyl)-2-(2-bromo-4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NC2C3CC4CC(C3)CC2C4)c(Br)c1 |
| InChI | InChI=1S/C19H24BrNO2/c1-11-2-3-17(16(20)4-11)23-10-18(22)21-19-14-6-12-5-13(8-14)9-15(19)7-12/h2-4,12-15,19H,5-10H2,1H3,(H,21,22) |
| InChIKey | NROJLMGRILTVKW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |