C21H25BrN4O3 — CID 3105733
3-[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]-N-[4-(dimethylamino)phenyl]butanamide (PubChem CID 3105733) has the molecular formula C21H25BrN4O3 and a molecular weight of 461.36 g/mol. Its IUPAC name is 3-[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]-N-[4-(dimethylamino)phenyl]butanamide.
| Compound Name | 3-[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]-N-[4-(dimethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 3105733 |
| Molecular Formula | C21H25BrN4O3 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]-N-[4-(dimethylamino)phenyl]butanamide |
| SMILES | CC(CC(=O)Nc1ccc(N(C)C)cc1)=NNC(=O)COc1ccc(C)cc1Br |
| InChI | InChI=1S/C21H25BrN4O3/c1-14-5-10-19(18(22)11-14)29-13-21(28)25-24-15(2)12-20(27)23-16-6-8-17(9-7-16)26(3)4/h5-11H,12-13H2,1-4H3,(H,23,27)(H,25,28) |
| InChIKey | RPEBGOCYMAHMEB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|