C21H26N4O3 — CID 3636955
N-[4-(dimethylamino)phenyl]-3-[[2-(4-methylphenoxy)acetyl]hydrazinylidene]butanamide (PubChem CID 3636955) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-3-[[2-(4-methylphenoxy)acetyl]hydrazinylidene]butanamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-3-[[2-(4-methylphenoxy)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 3636955 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-3-[[2-(4-methylphenoxy)acetyl]hydrazinylidene]butanamide |
| SMILES | CC(CC(=O)Nc1ccc(N(C)C)cc1)=NNC(=O)COc1ccc(C)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-15-5-11-19(12-6-15)28-14-21(27)24-23-16(2)13-20(26)22-17-7-9-18(10-8-17)25(3)4/h5-12H,13-14H2,1-4H3,(H,22,26)(H,24,27) |
| InChIKey | ALTZFSFMIYEXRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|