C20H26BrNO2 — CID 5022507
N-(1-adamantyl)-2-(4-bromo-2,5-dimethylphenoxy)acetamide (PubChem CID 5022507) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(4-bromo-2,5-dimethylphenoxy)acetamide.
| Compound Name | N-(1-adamantyl)-2-(4-bromo-2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 5022507 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(1-adamantyl)-2-(4-bromo-2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)NC23CC4CC(CC(C4)C2)C3)c(C)cc1Br |
| InChI | InChI=1S/C20H26BrNO2/c1-12-4-18(13(2)3-17(12)21)24-11-19(23)22-20-8-14-5-15(9-20)7-16(6-14)10-20/h3-4,14-16H,5-11H2,1-2H3,(H,22,23) |
| InChIKey | VASYQTGBEFXDNU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |