C17H26BrNO2 — CID 3901238
2-(4-bromo-2,5-dimethylphenoxy)-N-heptylacetamide (PubChem CID 3901238) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenoxy)-N-heptylacetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-heptylacetamide |
|---|---|
| PubChem CID | 3901238 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-heptylacetamide |
| SMILES | CCCCCCCNC(=O)COc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C17H26BrNO2/c1-4-5-6-7-8-9-19-17(20)12-21-16-11-13(2)15(18)10-14(16)3/h10-11H,4-9,12H2,1-3H3,(H,19,20) |
| InChIKey | HTZNTKMLFAYLJI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|