C21H23Br2N3O5 — CID 4592641
3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)butanamide (PubChem CID 4592641) has the molecular formula C21H23Br2N3O5 and a molecular weight of 557.24 g/mol. Its IUPAC name is 3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)butanamide.
| Compound Name | 3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 4592641 |
| Molecular Formula | C21H23Br2N3O5 |
| Molecular Weight | 557.24 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | 3-[[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CC(C)=NNC(=O)COc2cc(C)c(Br)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C21H23Br2N3O5/c1-12-7-18(16(23)10-15(12)22)31-11-21(28)26-25-13(2)8-20(27)24-17-6-5-14(29-3)9-19(17)30-4/h5-7,9-10H,8,11H2,1-4H3,(H,24,27)(H,26,28) |
| InChIKey | AIIRLOPCJXKGLT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|