C21H24Br2N4O3 — CID 3293783
3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-[4-(dimethylamino)phenyl]but-3-enamide (PubChem CID 3293783) has the molecular formula C21H24Br2N4O3 and a molecular weight of 540.26 g/mol. Its IUPAC name is 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-[4-(dimethylamino)phenyl]but-3-enamide.
| Compound Name | 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-[4-(dimethylamino)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 3293783 |
| Molecular Formula | C21H24Br2N4O3 |
| Molecular Weight | 540.26 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 3-[2-[2-(2,4-dibromo-5-methylphenoxy)acetyl]hydrazinyl]-N-[4-(dimethylamino)phenyl]but-3-enamide |
| SMILES | C=C(CC(=O)Nc1ccc(N(C)C)cc1)NNC(=O)COc1cc(C)c(Br)cc1Br |
| InChI | InChI=1S/C21H24Br2N4O3/c1-13-9-19(18(23)11-17(13)22)30-12-21(29)26-25-14(2)10-20(28)24-15-5-7-16(8-6-15)27(3)4/h5-9,11,25H,2,10,12H2,1,3-4H3,(H,24,28)(H,26,29) |
| InChIKey | DIUUFJYTBXKDOJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|