C9H7F6O3P — CID 87247575
1-fluoro-2-[fluoro(1,1,2,2-tetrafluoropropoxy)phosphoryl]oxybenzene (PubChem CID 87247575) has the molecular formula C9H7F6O3P and a molecular weight of 308.11 g/mol. Its IUPAC name is 1-fluoro-2-[fluoro(1,1,2,2-tetrafluoropropoxy)phosphoryl]oxybenzene.
| Compound Name | 1-fluoro-2-[fluoro(1,1,2,2-tetrafluoropropoxy)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 87247575 |
| Molecular Formula | C9H7F6O3P |
| Molecular Weight | 308.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-fluoro-2-[fluoro(1,1,2,2-tetrafluoropropoxy)phosphoryl]oxybenzene |
| SMILES | CC(F)(F)C(F)(F)OP(=O)(F)Oc1ccccc1F |
| InChI | InChI=1S/C9H7F6O3P/c1-8(11,12)9(13,14)18-19(15,16)17-7-5-3-2-4-6(7)10/h2-5H,1H3 |
| InChIKey | VBRKATZBUYGNHI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.11 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|