C24H28NO4P — CID 2313141
N-bis(2,3-dimethylphenoxy)phosphoryl-3-ethoxyaniline (PubChem CID 2313141) has the molecular formula C24H28NO4P and a molecular weight of 425.47 g/mol. Its IUPAC name is N-bis(2,3-dimethylphenoxy)phosphoryl-3-ethoxyaniline.
| Compound Name | N-bis(2,3-dimethylphenoxy)phosphoryl-3-ethoxyaniline |
|---|---|
| PubChem CID | 2313141 |
| Molecular Formula | C24H28NO4P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-bis(2,3-dimethylphenoxy)phosphoryl-3-ethoxyaniline |
| SMILES | CCOc1cccc(NP(=O)(Oc2cccc(C)c2C)Oc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C24H28NO4P/c1-6-27-22-13-9-12-21(16-22)25-30(26,28-23-14-7-10-17(2)19(23)4)29-24-15-8-11-18(3)20(24)5/h7-16H,6H2,1-5H3,(H,25,26) |
| InChIKey | XQUDUTAJXKXVON-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|