C14H25N2O3P — CID 23382952
1-N-diethoxyphosphoryl-4-N-ethyl-4-N,2-dimethylbenzene-1,4-diamine (PubChem CID 23382952) has the molecular formula C14H25N2O3P and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-N-diethoxyphosphoryl-4-N-ethyl-4-N,2-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-diethoxyphosphoryl-4-N-ethyl-4-N,2-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 23382952 |
| Molecular Formula | C14H25N2O3P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-N-diethoxyphosphoryl-4-N-ethyl-4-N,2-dimethylbenzene-1,4-diamine |
| SMILES | CCOP(=O)(Nc1ccc(N(C)CC)cc1C)OCC |
| InChI | InChI=1S/C14H25N2O3P/c1-6-16(5)13-9-10-14(12(4)11-13)15-20(17,18-7-2)19-8-3/h9-11H,6-8H2,1-5H3,(H,15,17) |
| InChIKey | SUSYEEDWNIMEPL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|