C17H21BrNO3P — CID 86305405
4-bromo-N-diethoxyphosphoryl-5-methyl-2-phenylaniline (PubChem CID 86305405) has the molecular formula C17H21BrNO3P and a molecular weight of 398.24 g/mol. Its IUPAC name is 4-bromo-N-diethoxyphosphoryl-5-methyl-2-phenylaniline.
| Compound Name | 4-bromo-N-diethoxyphosphoryl-5-methyl-2-phenylaniline |
|---|---|
| PubChem CID | 86305405 |
| Molecular Formula | C17H21BrNO3P |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-bromo-N-diethoxyphosphoryl-5-methyl-2-phenylaniline |
| SMILES | CCOP(=O)(Nc1cc(C)c(Br)cc1-c1ccccc1)OCC |
| InChI | InChI=1S/C17H21BrNO3P/c1-4-21-23(20,22-5-2)19-17-11-13(3)16(18)12-15(17)14-9-7-6-8-10-14/h6-12H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | BROXUNDNDKHUNQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|