C23H41NO5 — CID 21316516
ethyl 7-[1-(4-hydroxy-4-methylnonyl)-3,5-dioxopyrrolidin-2-yl]heptanoate (PubChem CID 21316516) has the molecular formula C23H41NO5 and a molecular weight of 411.58 g/mol. Its IUPAC name is ethyl 7-[1-(4-hydroxy-4-methylnonyl)-3,5-dioxopyrrolidin-2-yl]heptanoate.
| Compound Name | ethyl 7-[1-(4-hydroxy-4-methylnonyl)-3,5-dioxopyrrolidin-2-yl]heptanoate |
|---|---|
| PubChem CID | 21316516 |
| Molecular Formula | C23H41NO5 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | ethyl 7-[1-(4-hydroxy-4-methylnonyl)-3,5-dioxopyrrolidin-2-yl]heptanoate |
| SMILES | CCCCCC(C)(O)CCCN1C(=O)CC(=O)C1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C23H41NO5/c1-4-6-11-15-23(3,28)16-12-17-24-19(20(25)18-21(24)26)13-9-7-8-10-14-22(27)29-5-2/h19,28H,4-18H2,1-3H3 |
| InChIKey | AVNFJVIIHQECKQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|