C13H18Cl2O — CID 21316533
(1,1-dichloro-2-methyl-2-propan-2-yloxypropyl)benzene (PubChem CID 21316533) has the molecular formula C13H18Cl2O and a molecular weight of 261.19 g/mol. Its IUPAC name is (1,1-dichloro-2-methyl-2-propan-2-yloxypropyl)benzene.
| Compound Name | (1,1-dichloro-2-methyl-2-propan-2-yloxypropyl)benzene |
|---|---|
| PubChem CID | 21316533 |
| Molecular Formula | C13H18Cl2O |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (1,1-dichloro-2-methyl-2-propan-2-yloxypropyl)benzene |
| SMILES | CC(C)OC(C)(C)C(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C13H18Cl2O/c1-10(2)16-12(3,4)13(14,15)11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | ACYVECMPBOKCFK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|