About 2-chloropyridin-1-ium-1,3-diamine
2-chloropyridin-1-ium-1,3-diamine (PubChem CID 21318211) has the molecular formula C5H7ClN3+
and a molecular weight of 144.59 g/mol. Its IUPAC name is 2-chloropyridin-1-ium-1,3-diamine.
Molecular Properties
| Compound Name | 2-chloropyridin-1-ium-1,3-diamine |
| PubChem CID | 21318211 |
| Molecular Formula | C5H7ClN3+ |
| Molecular Weight | 144.59 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | 2-chloropyridin-1-ium-1,3-diamine |
| SMILES | Nc1ccc[n+](N)c1Cl |
| InChI | InChI=1S/C5H7ClN3/c6-5-4(7)2-1-3-9(5)8/h1-3H,7-8H2/q+1 |
| InChIKey | NAMYFLRWIXLILV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.59 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridin-1-ium-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridin-1-ium-1,3-diamine?
The IUPAC name of 2-chloropyridin-1-ium-1,3-diamine (CID 21318211) is 2-chloropyridin-1-ium-1,3-diamine.
What is the SMILES notation for 2-chloropyridin-1-ium-1,3-diamine?
The canonical SMILES for 2-chloropyridin-1-ium-1,3-diamine is Nc1ccc[n+](N)c1Cl.
What is the InChIKey of 2-chloropyridin-1-ium-1,3-diamine?
The InChIKey is NAMYFLRWIXLILV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN3/c6-5-4(7)2-1-3-9(5)8/h1-3H,7-8H2/q+1.
What are the key properties of 2-chloropyridin-1-ium-1,3-diamine?
2-chloropyridin-1-ium-1,3-diamine has a molecular weight of 144.59 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridin-1-ium-1,3-diamine is sourced from PubChem (CID 21318211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).