About 3-methylpyridin-1-ium-1,2-diamine
3-methylpyridin-1-ium-1,2-diamine (PubChem CID 4553263) has the molecular formula C6H10N3+
and a molecular weight of 124.17 g/mol. Its IUPAC name is 3-methylpyridin-1-ium-1,2-diamine.
Molecular Properties
| Compound Name | 3-methylpyridin-1-ium-1,2-diamine |
| PubChem CID | 4553263 |
| Molecular Formula | C6H10N3+ |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 3-methylpyridin-1-ium-1,2-diamine |
| SMILES | Cc1ccc[n+](N)c1N |
| InChI | InChI=1S/C6H9N3/c1-5-3-2-4-9(8)6(5)7/h2-4,7H,8H2,1H3/p+1 |
| InChIKey | BVNYEAFGAUOZSK-UHFFFAOYSA-O |
| XLogP | -0.42 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyridin-1-ium-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyridin-1-ium-1,2-diamine?
The IUPAC name of 3-methylpyridin-1-ium-1,2-diamine (CID 4553263) is 3-methylpyridin-1-ium-1,2-diamine.
What is the SMILES notation for 3-methylpyridin-1-ium-1,2-diamine?
The canonical SMILES for 3-methylpyridin-1-ium-1,2-diamine is Cc1ccc[n+](N)c1N.
What is the InChIKey of 3-methylpyridin-1-ium-1,2-diamine?
The InChIKey is BVNYEAFGAUOZSK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9N3/c1-5-3-2-4-9(8)6(5)7/h2-4,7H,8H2,1H3/p+1.
What are the key properties of 3-methylpyridin-1-ium-1,2-diamine?
3-methylpyridin-1-ium-1,2-diamine has a molecular weight of 124.17 g/mol, XLogP of -0.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyridin-1-ium-1,2-diamine is sourced from PubChem (CID 4553263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).