About 11H-indolo[1,2-a]benzimidazole
11H-indolo[1,2-a]benzimidazole (PubChem CID 21319350) has the molecular formula C14H10N2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 11H-indolo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 11H-indolo[1,2-a]benzimidazole |
| PubChem CID | 21319350 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 11H-indolo[1,2-a]benzimidazole |
| SMILES | c1ccc2c(c1)Cc1nc3ccccc3n1-2 |
| InChI | InChI=1S/C14H10N2/c1-3-7-12-10(5-1)9-14-15-11-6-2-4-8-13(11)16(12)14/h1-8H,9H2 |
| InChIKey | TXCVALVFXRQIFY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11H-indolo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-indolo[1,2-a]benzimidazole?
The IUPAC name of 11H-indolo[1,2-a]benzimidazole (CID 21319350) is 11H-indolo[1,2-a]benzimidazole.
What is the SMILES notation for 11H-indolo[1,2-a]benzimidazole?
The canonical SMILES for 11H-indolo[1,2-a]benzimidazole is c1ccc2c(c1)Cc1nc3ccccc3n1-2.
What is the InChIKey of 11H-indolo[1,2-a]benzimidazole?
The InChIKey is TXCVALVFXRQIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2/c1-3-7-12-10(5-1)9-14-15-11-6-2-4-8-13(11)16(12)14/h1-8H,9H2.
What are the key properties of 11H-indolo[1,2-a]benzimidazole?
11H-indolo[1,2-a]benzimidazole has a molecular weight of 206.25 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-indolo[1,2-a]benzimidazole is sourced from PubChem (CID 21319350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).