C26H34ClNO6 — CID 21322666
ethyl 2-[4-[2-[2-(4-chlorophenoxy)hexanoylamino]ethyl]phenoxy]-2-methoxypropanoate (PubChem CID 21322666) has the molecular formula C26H34ClNO6 and a molecular weight of 492.01 g/mol. Its IUPAC name is ethyl 2-[4-[2-[2-(4-chlorophenoxy)hexanoylamino]ethyl]phenoxy]-2-methoxypropanoate.
| Compound Name | ethyl 2-[4-[2-[2-(4-chlorophenoxy)hexanoylamino]ethyl]phenoxy]-2-methoxypropanoate |
|---|---|
| PubChem CID | 21322666 |
| Molecular Formula | C26H34ClNO6 |
| Molecular Weight | 492.01 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | ethyl 2-[4-[2-[2-(4-chlorophenoxy)hexanoylamino]ethyl]phenoxy]-2-methoxypropanoate |
| SMILES | CCCCC(Oc1ccc(Cl)cc1)C(=O)NCCc1ccc(OC(C)(OC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H34ClNO6/c1-5-7-8-23(33-21-15-11-20(27)12-16-21)24(29)28-18-17-19-9-13-22(14-10-19)34-26(3,31-4)25(30)32-6-2/h9-16,23H,5-8,17-18H2,1-4H3,(H,28,29) |
| InChIKey | UEQDMSHPXVFVTP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|