C19H14F2N2O3S — CID 2132378
2-[[4-(difluoromethoxy)benzoyl]amino]-5-phenylthiophene-3-carboxamide (PubChem CID 2132378) has the molecular formula C19H14F2N2O3S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)benzoyl]amino]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-[[4-(difluoromethoxy)benzoyl]amino]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 2132378 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[[4-(difluoromethoxy)benzoyl]amino]-5-phenylthiophene-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)sc1NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H14F2N2O3S/c20-19(21)26-13-8-6-12(7-9-13)17(25)23-18-14(16(22)24)10-15(27-18)11-4-2-1-3-5-11/h1-10,19H,(H2,22,24)(H,23,25) |
| InChIKey | SXRGBBSPIQXETB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |