C14H14N2O4S — CID 4106590
2-[(3,4-dimethoxybenzoyl)amino]thiophene-3-carboxamide (PubChem CID 4106590) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[(3,4-dimethoxybenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(3,4-dimethoxybenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4106590 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[(3,4-dimethoxybenzoyl)amino]thiophene-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2sccc2C(N)=O)cc1OC |
| InChI | InChI=1S/C14H14N2O4S/c1-19-10-4-3-8(7-11(10)20-2)13(18)16-14-9(12(15)17)5-6-21-14/h3-7H,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | LORRZRFBMUDPOE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |