C29H35NO4 — CID 21324576
ethyl 4-methoxy-1,10,14-trimethyl-12-(4-methylbenzoyl)-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 21324576) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is ethyl 4-methoxy-1,10,14-trimethyl-12-(4-methylbenzoyl)-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl 4-methoxy-1,10,14-trimethyl-12-(4-methylbenzoyl)-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 21324576 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | ethyl 4-methoxy-1,10,14-trimethyl-12-(4-methylbenzoyl)-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)c2ccc(C)cc2)CC2(C)C3Cc4ccc(OC)cc4C2(C)CC1N3C |
| InChI | InChI=1S/C29H35NO4/c1-7-34-26(32)29(25(31)19-10-8-18(2)9-11-19)17-28(4)23-14-20-12-13-21(33-6)15-22(20)27(28,3)16-24(29)30(23)5/h8-13,15,23-24H,7,14,16-17H2,1-6H3 |
| InChIKey | AXQWHLIDUAEKOW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|