C9H14N2O2S2 — CID 21328002
3-piperidin-1-ylthiophene-2-sulfonamide (PubChem CID 21328002) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 3-piperidin-1-ylthiophene-2-sulfonamide.
| Compound Name | 3-piperidin-1-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 21328002 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-piperidin-1-ylthiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1sccc1N1CCCCC1 |
| InChI | InChI=1S/C9H14N2O2S2/c10-15(12,13)9-8(4-7-14-9)11-5-2-1-3-6-11/h4,7H,1-3,5-6H2,(H2,10,12,13) |
| InChIKey | LIUXGDPKOSEDJA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |