About 6-acetyl-1,3-benzothiazine-2,4-dione
6-acetyl-1,3-benzothiazine-2,4-dione (PubChem CID 21331324) has the molecular formula C10H7NO3S
and a molecular weight of 221.24 g/mol. Its IUPAC name is 6-acetyl-1,3-benzothiazine-2,4-dione.
Molecular Properties
| Compound Name | 6-acetyl-1,3-benzothiazine-2,4-dione |
| PubChem CID | 21331324 |
| Molecular Formula | C10H7NO3S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 6-acetyl-1,3-benzothiazine-2,4-dione |
| SMILES | CC(=O)c1ccc2sc(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H7NO3S/c1-5(12)6-2-3-8-7(4-6)9(13)11-10(14)15-8/h2-4H,1H3,(H,11,13,14) |
| InChIKey | ONZIYTUIGGRHIV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-acetyl-1,3-benzothiazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-1,3-benzothiazine-2,4-dione?
The IUPAC name of 6-acetyl-1,3-benzothiazine-2,4-dione (CID 21331324) is 6-acetyl-1,3-benzothiazine-2,4-dione.
What is the SMILES notation for 6-acetyl-1,3-benzothiazine-2,4-dione?
The canonical SMILES for 6-acetyl-1,3-benzothiazine-2,4-dione is CC(=O)c1ccc2sc(=O)[nH]c(=O)c2c1.
What is the InChIKey of 6-acetyl-1,3-benzothiazine-2,4-dione?
The InChIKey is ONZIYTUIGGRHIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3S/c1-5(12)6-2-3-8-7(4-6)9(13)11-10(14)15-8/h2-4H,1H3,(H,11,13,14).
What are the key properties of 6-acetyl-1,3-benzothiazine-2,4-dione?
6-acetyl-1,3-benzothiazine-2,4-dione has a molecular weight of 221.24 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-1,3-benzothiazine-2,4-dione is sourced from PubChem (CID 21331324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).