C9H10FO4S- — CID 21333676
2-(2-fluoro-4-methylphenoxy)ethanesulfonate (PubChem CID 21333676) has the molecular formula C9H10FO4S- and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenoxy)ethanesulfonate.
| Compound Name | 2-(2-fluoro-4-methylphenoxy)ethanesulfonate |
|---|---|
| PubChem CID | 21333676 |
| Molecular Formula | C9H10FO4S- |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-(2-fluoro-4-methylphenoxy)ethanesulfonate |
| SMILES | Cc1ccc(OCCS(=O)(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C9H11FO4S/c1-7-2-3-9(8(10)6-7)14-4-5-15(11,12)13/h2-3,6H,4-5H2,1H3,(H,11,12,13)/p-1 |
| InChIKey | GVQYHWJPIIEQSU-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|