C20H29NO — CID 21334076
[1-(1-methylcyclohexyl)piperidin-4-yl]-(4-methylphenyl)methanone (PubChem CID 21334076) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is [1-(1-methylcyclohexyl)piperidin-4-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-(1-methylcyclohexyl)piperidin-4-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 21334076 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | [1-(1-methylcyclohexyl)piperidin-4-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(C3(C)CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H29NO/c1-16-6-8-17(9-7-16)19(22)18-10-14-21(15-11-18)20(2)12-4-3-5-13-20/h6-9,18H,3-5,10-15H2,1-2H3 |
| InChIKey | WBQOPNYCHALUOT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |