C12H8F7NO4S — CID 2133542
2,2,3,3-tetrafluoropropyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate (PubChem CID 2133542) has the molecular formula C12H8F7NO4S and a molecular weight of 395.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 2133542 |
| Molecular Formula | C12H8F7NO4S |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H8F7NO4S/c13-10(14)11(15,16)5-24-9(21)4-25-8-2-1-6(12(17,18)19)3-7(8)20(22)23/h1-3,10H,4-5H2 |
| InChIKey | RFVWCCKQQKYQDJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|