C25H29N5O3 — CID 21335982
2-[2-(2-hydroxyethoxy)-5-methylphenyl]-N-[2,4,6-trimethyl-3-(6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)phenyl]acetamide (PubChem CID 21335982) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)-5-methylphenyl]-N-[2,4,6-trimethyl-3-(6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)phenyl]acetamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)-5-methylphenyl]-N-[2,4,6-trimethyl-3-(6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 21335982 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)-5-methylphenyl]-N-[2,4,6-trimethyl-3-(6-methyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)phenyl]acetamide |
| SMILES | Cc1ccc(OCCO)c(CC(=O)Nc2c(C)cc(C)c(-c3nnc4cc(C)[nH]n34)c2C)c1 |
| InChI | InChI=1S/C25H29N5O3/c1-14-6-7-20(33-9-8-31)19(10-14)13-22(32)26-24-16(3)11-15(2)23(18(24)5)25-28-27-21-12-17(4)29-30(21)25/h6-7,10-12,29,31H,8-9,13H2,1-5H3,(H,26,32) |
| InChIKey | MUBRIKOJPBCHST-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |