About 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene
1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene (PubChem CID 21336391) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene.
Analyze 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene?
The IUPAC name of 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene (CID 21336391) is 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene.
What is the SMILES notation for 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene?
The canonical SMILES for 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene is C=C1C(C)=C(C)CC(C)=C1C.
What is the InChIKey of 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene?
The InChIKey is KPUFWBPMEMPQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-7-6-8(2)10(4)11(5)9(7)3/h5-6H2,1-4H3.
What are the key properties of 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene?
1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene has a molecular weight of 148.25 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetramethyl-3-methylidenecyclohexa-1,4-diene is sourced from PubChem (CID 21336391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).