C29H38N2O4S — CID 21337495
N-[4-(3-acetyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-hydroxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide (PubChem CID 21337495) has the molecular formula C29H38N2O4S and a molecular weight of 510.70 g/mol. Its IUPAC name is N-[4-(3-acetyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-hydroxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide.
| Compound Name | N-[4-(3-acetyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-hydroxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 21337495 |
| Molecular Formula | C29H38N2O4S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N-[4-(3-acetyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-hydroxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
| SMILES | CC(=O)C1CC2CCCCC2CN1CC(O)C(CSc1ccccc1)NC(=O)c1cccc(O)c1C |
| InChI | InChI=1S/C29H38N2O4S/c1-19-24(13-8-14-27(19)33)29(35)30-25(18-36-23-11-4-3-5-12-23)28(34)17-31-16-22-10-7-6-9-21(22)15-26(31)20(2)32/h3-5,8,11-14,21-22,25-26,28,33-34H,6-7,9-10,15-18H2,1-2H3,(H,30,35) |
| InChIKey | TUHUJZMUCUHWOE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |