C30H42N2O3S — CID 59080716
N-[(2R,3R)-4-[(3S,4aS,8aS)-3-[(1S)-1-hydroxyethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-2,3-dimethylbenzamide (PubChem CID 59080716) has the molecular formula C30H42N2O3S and a molecular weight of 510.74 g/mol. Its IUPAC name is N-[(2R,3R)-4-[(3S,4aS,8aS)-3-[(1S)-1-hydroxyethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-2,3-dimethylbenzamide.
| Compound Name | N-[(2R,3R)-4-[(3S,4aS,8aS)-3-[(1S)-1-hydroxyethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 59080716 |
| Molecular Formula | C30H42N2O3S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-[(2R,3R)-4-[(3S,4aS,8aS)-3-[(1S)-1-hydroxyethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN2C[C@H]3CCCC[C@H]3C[C@H]2[C@H](C)O)c1C |
| InChI | InChI=1S/C30H42N2O3S/c1-20-10-9-15-26(21(20)2)30(35)31-27(19-36-25-13-5-4-6-14-25)29(34)18-32-17-24-12-8-7-11-23(24)16-28(32)22(3)33/h4-6,9-10,13-15,22-24,27-29,33-34H,7-8,11-12,16-19H2,1-3H3,(H,31,35)/t22-,23-,24+,27-,28-,29+/m0/s1 |
| InChIKey | ZRKQPRJQEOLWMP-SWMCPTKDSA-N |
| XLogP | 4.82 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |