C31H42N2O5S — CID 20695564
[3-[[3-hydroxy-4-[3-(1-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 20695564) has the molecular formula C31H42N2O5S and a molecular weight of 554.75 g/mol. Its IUPAC name is [3-[[3-hydroxy-4-[3-(1-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[3-hydroxy-4-[3-(1-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 20695564 |
| Molecular Formula | C31H42N2O5S |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | [3-[[3-hydroxy-4-[3-(1-hydroxyethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC(CSc2ccccc2)C(O)CN2CC3CCCCC3CC2C(C)O)c1C |
| InChI | InChI=1S/C31H42N2O5S/c1-20-26(14-9-15-30(20)38-22(3)35)31(37)32-27(19-39-25-12-5-4-6-13-25)29(36)18-33-17-24-11-8-7-10-23(24)16-28(33)21(2)34/h4-6,9,12-15,21,23-24,27-29,34,36H,7-8,10-11,16-19H2,1-3H3,(H,32,37) |
| InChIKey | JTNMJZRDOBYCFL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|