C10H12N3W- — CID 21337557
[(2Z)-1-(5-aminopyrazol-1-yl)-2,4-dimethylpenta-2,4-dienylidene]tungsten (PubChem CID 21337557) has the molecular formula C10H12N3W- and a molecular weight of 358.07 g/mol. Its IUPAC name is [(2Z)-1-(5-aminopyrazol-1-yl)-2,4-dimethylpenta-2,4-dienylidene]tungsten.
| Compound Name | [(2Z)-1-(5-aminopyrazol-1-yl)-2,4-dimethylpenta-2,4-dienylidene]tungsten |
|---|---|
| PubChem CID | 21337557 |
| Molecular Formula | C10H12N3W- |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [(2Z)-1-(5-aminopyrazol-1-yl)-2,4-dimethylpenta-2,4-dienylidene]tungsten |
| SMILES | [H]/[C-]=C(C)/C=C(/C)C(=[W])n1nccc1N |
| InChI | InChI=1S/C10H12N3.W/c1-8(2)6-9(3)7-13-10(11)4-5-12-13;/h1,4-6H,11H2,2-3H3;/q-1;/b9-6-; |
| InChIKey | ZJOQMIGGTRRLFV-BORNJIKYSA-N |
| XLogP | 1.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|