About CID 21338121
CID 21338121 (PubChem CID 21338121) has the molecular formula C6B2F4
and a molecular weight of 169.68 g/mol.
Molecular Properties
| Compound Name | CID 21338121 |
| PubChem CID | 21338121 |
| Molecular Formula | C6B2F4 |
| Molecular Weight | 169.68 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6B2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | NVJAQHBUWRYFRI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.68 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21338121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21338121?
The IUPAC name of CID 21338121 (CID 21338121) is not available.
What is the SMILES notation for CID 21338121?
The canonical SMILES for CID 21338121 is [B]c1c([B])c(F)c(F)c(F)c1F.
What is the InChIKey of CID 21338121?
The InChIKey is NVJAQHBUWRYFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6B2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9.
What are the key properties of CID 21338121?
CID 21338121 has a molecular weight of 169.68 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21338121 is sourced from PubChem (CID 21338121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).