C6F5Ti- — CID 87571905
1,2,3,4,5-pentafluorobenzene-6-ide;titanium (PubChem CID 87571905) has the molecular formula C6F5Ti- and a molecular weight of 214.92 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluorobenzene-6-ide;titanium.
| Compound Name | 1,2,3,4,5-pentafluorobenzene-6-ide;titanium |
|---|---|
| PubChem CID | 87571905 |
| Molecular Formula | C6F5Ti- |
| Molecular Weight | 214.92 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 1,2,3,4,5-pentafluorobenzene-6-ide;titanium |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[Ti] |
| InChI | InChI=1S/C6F5.Ti/c7-2-1-3(8)5(10)6(11)4(2)9;/q-1; |
| InChIKey | UWBMNWHRZQHJHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.92 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|