C14ClF9Mg — CID 90189953
magnesium;1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracen-2-ide;chloride (PubChem CID 90189953) has the molecular formula C14ClF9Mg and a molecular weight of 398.89 g/mol. Its IUPAC name is magnesium;1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracen-2-ide;chloride.
| Compound Name | magnesium;1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracen-2-ide;chloride |
|---|---|
| PubChem CID | 90189953 |
| Molecular Formula | C14ClF9Mg |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | magnesium;1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracen-2-ide;chloride |
| SMILES | Fc1[c-]c(F)c2c(F)c3c(F)c(F)c(F)c(F)c3c(F)c2c1F.[Cl-].[Mg+2] |
| InChI | InChI=1S/C14F9.ClH.Mg/c15-2-1-3(16)8(17)5-4(2)9(18)6-7(10(5)19)12(21)14(23)13(22)11(6)20;;/h;1H;/q-1;;+2/p-1 |
| InChIKey | UBKPQUVGFBAIAW-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|