C10BrF7Mg — CID 87467832
magnesium;2,3,4,5,6,7,8-heptafluoro-1H-naphthalen-1-ide;bromide (PubChem CID 87467832) has the molecular formula C10BrF7Mg and a molecular weight of 357.31 g/mol. Its IUPAC name is magnesium;2,3,4,5,6,7,8-heptafluoro-1H-naphthalen-1-ide;bromide.
| Compound Name | magnesium;2,3,4,5,6,7,8-heptafluoro-1H-naphthalen-1-ide;bromide |
|---|---|
| PubChem CID | 87467832 |
| Molecular Formula | C10BrF7Mg |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 355.89 |
| IUPAC Name | magnesium;2,3,4,5,6,7,8-heptafluoro-1H-naphthalen-1-ide;bromide |
| SMILES | Fc1[c-]c2c(F)c(F)c(F)c(F)c2c(F)c1F.[Br-].[Mg+2] |
| InChI | InChI=1S/C10F7.BrH.Mg/c11-3-1-2-4(7(14)6(3)13)8(15)10(17)9(16)5(2)12;;/h;1H;/q-1;;+2/p-1 |
| InChIKey | WZYWXFNEGAREOF-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|